C17H21N7O4S2 — CID 70855794
2-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-methylethanesulfonamide (PubChem CID 70855794) has the molecular formula C17H21N7O4S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-methylethanesulfonamide.
| Compound Name | 2-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 70855794 |
| Molecular Formula | C17H21N7O4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 2-[6-amino-8-[[6-(dimethylamino)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCn1c(Sc2cc3c(cc2N(C)C)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H21N7O4S2/c1-19-30(25,26)5-4-24-16-14(15(18)20-8-21-16)22-17(24)29-13-7-12-11(27-9-28-12)6-10(13)23(2)3/h6-8,19H,4-5,9H2,1-3H3,(H2,18,20,21) |
| InChIKey | LDUBDPOWKPVSTA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|