C18H21IN6O4S2 — CID 66562687
2-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-N-tert-butylethanesulfonamide (PubChem CID 66562687) has the molecular formula C18H21IN6O4S2 and a molecular weight of 576.44 g/mol. Its IUPAC name is 2-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-N-tert-butylethanesulfonamide.
| Compound Name | 2-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-N-tert-butylethanesulfonamide |
|---|---|
| PubChem CID | 66562687 |
| Molecular Formula | C18H21IN6O4S2 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 576.01 |
| IUPAC Name | 2-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]-N-tert-butylethanesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21IN6O4S2/c1-18(2,3)24-31(26,27)5-4-25-16-14(15(20)21-8-22-16)23-17(25)30-13-7-12-11(6-10(13)19)28-9-29-12/h6-8,24H,4-5,9H2,1-3H3,(H2,20,21,22) |
| InChIKey | BVZDQXMRXILCQR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|