C15H14IN5O5S2 — CID 91256640
3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propane-1-sulfonic acid (PubChem CID 91256640) has the molecular formula C15H14IN5O5S2 and a molecular weight of 535.35 g/mol. Its IUPAC name is 3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propane-1-sulfonic acid.
| Compound Name | 3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91256640 |
| Molecular Formula | C15H14IN5O5S2 |
| Molecular Weight | 535.35 g/mol |
| Exact Mass | 534.95 |
| IUPAC Name | 3-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]propane-1-sulfonic acid |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CCCS(=O)(=O)O |
| InChI | InChI=1S/C15H14IN5O5S2/c16-8-4-9-10(26-7-25-9)5-11(8)27-15-20-12-13(17)18-6-19-14(12)21(15)2-1-3-28(22,23)24/h4-6H,1-3,7H2,(H2,17,18,19)(H,22,23,24) |
| InChIKey | DUDUCFWCDDVVQO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 142.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|