C21H23IN6O4S — CID 24956982
cyclopentyl (2S)-2-amino-4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanoate (PubChem CID 24956982) has the molecular formula C21H23IN6O4S and a molecular weight of 582.42 g/mol. Its IUPAC name is cyclopentyl (2S)-2-amino-4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanoate.
| Compound Name | cyclopentyl (2S)-2-amino-4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanoate |
|---|---|
| PubChem CID | 24956982 |
| Molecular Formula | C21H23IN6O4S |
| Molecular Weight | 582.42 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | cyclopentyl (2S)-2-amino-4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanoate |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1I)OCO3)n2CC[C@H](N)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C21H23IN6O4S/c22-12-7-14-15(31-10-30-14)8-16(12)33-21-27-17-18(24)25-9-26-19(17)28(21)6-5-13(23)20(29)32-11-3-1-2-4-11/h7-9,11,13H,1-6,10,23H2,(H2,24,25,26)/t13-/m0/s1 |
| InChIKey | ICQLXAJNGSBDPA-ZDUSSCGKSA-N |
| XLogP | 3.10 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|