C16H15IN6O3S — CID 68653127
4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanamide (PubChem CID 68653127) has the molecular formula C16H15IN6O3S and a molecular weight of 498.31 g/mol. Its IUPAC name is 4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanamide.
| Compound Name | 4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanamide |
|---|---|
| PubChem CID | 68653127 |
| Molecular Formula | C16H15IN6O3S |
| Molecular Weight | 498.31 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 4-[6-amino-8-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]butanamide |
| SMILES | NC(=O)CCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H15IN6O3S/c17-8-4-9-10(26-7-25-9)5-11(8)27-16-22-13-14(19)20-6-21-15(13)23(16)3-1-2-12(18)24/h4-6H,1-3,7H2,(H2,18,24)(H2,19,20,21) |
| InChIKey | COLSSQZFYMIQEA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|