C22H25N7O4S3 — CID 70855350
N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropane-1-sulfonamide (PubChem CID 70855350) has the molecular formula C22H25N7O4S3 and a molecular weight of 547.69 g/mol. Its IUPAC name is N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropane-1-sulfonamide.
| Compound Name | N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 70855350 |
| Molecular Formula | C22H25N7O4S3 |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | N-[3-[6-amino-8-[[6-(1,3-thiazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropane-1-sulfonamide |
| SMILES | CC(C)CS(=O)(=O)NCCCn1c(Sc2cc3c(cc2-c2nccs2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C22H25N7O4S3/c1-13(2)10-36(30,31)27-4-3-6-29-20-18(19(23)25-11-26-20)28-22(29)35-17-9-16-15(32-12-33-16)8-14(17)21-24-5-7-34-21/h5,7-9,11,13,27H,3-4,6,10,12H2,1-2H3,(H2,23,25,26) |
| InChIKey | LYGLJMFKNYUEKD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|