C20H20N6O3S — CID 121353045
9-[2-(ethylamino)ethyl]-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine (PubChem CID 121353045) has the molecular formula C20H20N6O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 9-[2-(ethylamino)ethyl]-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[2-(ethylamino)ethyl]-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 121353045 |
| Molecular Formula | C20H20N6O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 9-[2-(ethylamino)ethyl]-8-[[6-(furan-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
| SMILES | CCNCCn1c(Sc2cc3c(cc2-c2ccco2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H20N6O3S/c1-2-22-5-6-26-19-17(18(21)23-10-24-19)25-20(26)30-16-9-15-14(28-11-29-15)8-12(16)13-4-3-7-27-13/h3-4,7-10,22H,2,5-6,11H2,1H3,(H2,21,23,24) |
| InChIKey | ZDSVDMRRYBUGPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|