C21H23N7O4S — CID 122667924
3-[2-[6-amino-8-[2-(furan-2-yl)-5-methoxyphenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide (PubChem CID 122667924) has the molecular formula C21H23N7O4S and a molecular weight of 469.53 g/mol. Its IUPAC name is 3-[2-[6-amino-8-[2-(furan-2-yl)-5-methoxyphenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide.
| Compound Name | 3-[2-[6-amino-8-[2-(furan-2-yl)-5-methoxyphenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 122667924 |
| Molecular Formula | C21H23N7O4S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 3-[2-[6-amino-8-[2-(furan-2-yl)-5-methoxyphenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide |
| SMILES | COc1ccc(-c2ccco2)c(Sc2nc3c(N)ncnc3n2CCNCCC(=O)NO)c1 |
| InChI | InChI=1S/C21H23N7O4S/c1-31-13-4-5-14(15-3-2-10-32-15)16(11-13)33-21-26-18-19(22)24-12-25-20(18)28(21)9-8-23-7-6-17(29)27-30/h2-5,10-12,23,30H,6-9H2,1H3,(H,27,29)(H2,22,24,25) |
| InChIKey | KDXJGKZWRIWKHB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|