C17H21IN6OS — CID 16738429
8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[2-(propylamino)ethyl]purin-6-amine (PubChem CID 16738429) has the molecular formula C17H21IN6OS and a molecular weight of 484.37 g/mol. Its IUPAC name is 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[2-(propylamino)ethyl]purin-6-amine.
| Compound Name | 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[2-(propylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 16738429 |
| Molecular Formula | C17H21IN6OS |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[2-(propylamino)ethyl]purin-6-amine |
| SMILES | CCCNCCn1c(Sc2cc(OC)ccc2I)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H21IN6OS/c1-3-6-20-7-8-24-16-14(15(19)21-10-22-16)23-17(24)26-13-9-11(25-2)4-5-12(13)18/h4-5,9-10,20H,3,6-8H2,1-2H3,(H2,19,21,22) |
| InChIKey | KPSOHYMNDTTWLP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|