C18H23IN6OS — CID 16737867
8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[3-(propylamino)propyl]purin-6-amine (PubChem CID 16737867) has the molecular formula C18H23IN6OS and a molecular weight of 498.39 g/mol. Its IUPAC name is 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[3-(propylamino)propyl]purin-6-amine.
| Compound Name | 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[3-(propylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 16737867 |
| Molecular Formula | C18H23IN6OS |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 8-(2-iodo-5-methoxyphenyl)sulfanyl-9-[3-(propylamino)propyl]purin-6-amine |
| SMILES | CCCNCCCn1c(Sc2cc(OC)ccc2I)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H23IN6OS/c1-3-7-21-8-4-9-25-17-15(16(20)22-11-23-17)24-18(25)27-14-10-12(26-2)5-6-13(14)19/h5-6,10-11,21H,3-4,7-9H2,1-2H3,(H2,20,22,23) |
| InChIKey | BYXHWXLSCYCFSN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|