C15H17IN6OS — CID 16737864
9-(3-aminopropyl)-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine (PubChem CID 16737864) has the molecular formula C15H17IN6OS and a molecular weight of 456.31 g/mol. Its IUPAC name is 9-(3-aminopropyl)-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine.
| Compound Name | 9-(3-aminopropyl)-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine |
|---|---|
| PubChem CID | 16737864 |
| Molecular Formula | C15H17IN6OS |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 9-(3-aminopropyl)-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCCN)c1 |
| InChI | InChI=1S/C15H17IN6OS/c1-23-9-3-4-10(16)11(7-9)24-15-21-12-13(18)19-8-20-14(12)22(15)6-2-5-17/h3-4,7-8H,2,5-6,17H2,1H3,(H2,18,19,20) |
| InChIKey | LNPZPYDTNKIUOY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|