C14H13AsIN5OS — CID 87783797
CID 87783797 (PubChem CID 87783797) has the molecular formula C14H13AsIN5OS and a molecular weight of 501.19 g/mol.
| Compound Name | CID 87783797 |
|---|---|
| PubChem CID | 87783797 |
| Molecular Formula | C14H13AsIN5OS |
| Molecular Weight | 501.19 g/mol |
| Exact Mass | 500.91 |
| IUPAC Name | — |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2C(C)[As])c1 |
| InChI | InChI=1S/C14H13AsIN5OS/c1-7(15)21-13-11(12(17)18-6-19-13)20-14(21)23-10-5-8(22-2)3-4-9(10)16/h3-7H,1-2H3,(H2,17,18,19) |
| InChIKey | TUHBDYFCNGDXBG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|