C25H34IN7O3S — CID 16737330
tert-butyl 4-[3-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]propylamino]piperidine-1-carboxylate (PubChem CID 16737330) has the molecular formula C25H34IN7O3S and a molecular weight of 639.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]propylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]propylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 16737330 |
| Molecular Formula | C25H34IN7O3S |
| Molecular Weight | 639.56 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | tert-butyl 4-[3-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]propylamino]piperidine-1-carboxylate |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCCNC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C25H34IN7O3S/c1-25(2,3)36-24(34)32-12-8-16(9-13-32)28-10-5-11-33-22-20(21(27)29-15-30-22)31-23(33)37-19-14-17(35-4)6-7-18(19)26/h6-7,14-16,28H,5,8-13H2,1-4H3,(H2,27,29,30) |
| InChIKey | TVAOFZOKUCUCDZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|