C18H20N6O3S2 — CID 122667828
N-[3-[6-amino-8-(2-ethynyl-5-methoxyphenyl)sulfanylpurin-9-yl]propyl]methanesulfonamide (PubChem CID 122667828) has the molecular formula C18H20N6O3S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is N-[3-[6-amino-8-(2-ethynyl-5-methoxyphenyl)sulfanylpurin-9-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[6-amino-8-(2-ethynyl-5-methoxyphenyl)sulfanylpurin-9-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 122667828 |
| Molecular Formula | C18H20N6O3S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[3-[6-amino-8-(2-ethynyl-5-methoxyphenyl)sulfanylpurin-9-yl]propyl]methanesulfonamide |
| SMILES | C#Cc1ccc(OC)cc1Sc1nc2c(N)ncnc2n1CCCNS(C)(=O)=O |
| InChI | InChI=1S/C18H20N6O3S2/c1-4-12-6-7-13(27-2)10-14(12)28-18-23-15-16(19)20-11-21-17(15)24(18)9-5-8-22-29(3,25)26/h1,6-7,10-11,22H,5,8-9H2,2-3H3,(H2,19,20,21) |
| InChIKey | GFQQYOJYXRAXOR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|