C20H22N6O2S2 — CID 66562590
N-[3-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]methanesulfonamide (PubChem CID 66562590) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is N-[3-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 66562590 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[3-[6-amino-8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]methanesulfonamide |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNS(C)(=O)=O)CCC2 |
| InChI | InChI=1S/C20H22N6O2S2/c1-3-13-10-14-6-4-7-15(14)11-16(13)29-20-25-17-18(21)22-12-23-19(17)26(20)9-5-8-24-30(2,27)28/h1,10-12,24H,4-9H2,2H3,(H2,21,22,23) |
| InChIKey | LWSLQLQARTWXQY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|