C22H26N6S — CID 51347044
8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 51347044) has the molecular formula C22H26N6S and a molecular weight of 406.56 g/mol. Its IUPAC name is 8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | 8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 51347044 |
| Molecular Formula | C22H26N6S |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 8-[(6-ethynyl-2,3-dihydro-1H-inden-5-yl)sulfanyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(C)C)CCC2 |
| InChI | InChI=1S/C22H26N6S/c1-4-15-11-16-7-5-8-17(16)12-18(15)29-22-27-19-20(23)25-13-26-21(19)28(22)10-6-9-24-14(2)3/h1,11-14,24H,5-10H2,2-3H3,(H2,23,25,26) |
| InChIKey | PBADZXDQQDMYCL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|