C17H19Cl2IN6S — CID 121459805
8-(3,5-dichloro-2-iodophenyl)sulfanyl-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 121459805) has the molecular formula C17H19Cl2IN6S and a molecular weight of 537.26 g/mol. Its IUPAC name is 8-(3,5-dichloro-2-iodophenyl)sulfanyl-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | 8-(3,5-dichloro-2-iodophenyl)sulfanyl-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 121459805 |
| Molecular Formula | C17H19Cl2IN6S |
| Molecular Weight | 537.26 g/mol |
| Exact Mass | 535.98 |
| IUPAC Name | 8-(3,5-dichloro-2-iodophenyl)sulfanyl-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | CC(C)NCCCn1c(Sc2cc(Cl)cc(Cl)c2I)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H19Cl2IN6S/c1-9(2)22-4-3-5-26-16-14(15(21)23-8-24-16)25-17(26)27-12-7-10(18)6-11(19)13(12)20/h6-9,22H,3-5H2,1-2H3,(H2,21,23,24) |
| InChIKey | XPQFPJPGZLIOSE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.26 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|