C21H26N6O2S — CID 102315651
9-[3-(propan-2-ylamino)propyl]-8-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine (PubChem CID 102315651) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 9-[3-(propan-2-ylamino)propyl]-8-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-[3-(propan-2-ylamino)propyl]-8-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 102315651 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 9-[3-(propan-2-ylamino)propyl]-8-[(6-prop-2-enyl-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
| SMILES | C=CCc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(C)C)OCO2 |
| InChI | InChI=1S/C21H26N6O2S/c1-4-6-14-9-15-16(29-12-28-15)10-17(14)30-21-26-18-19(22)24-11-25-20(18)27(21)8-5-7-23-13(2)3/h4,9-11,13,23H,1,5-8,12H2,2-3H3,(H2,22,24,25) |
| InChIKey | FBOGFAOPMHWWOO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|