C22H28N6O2S — CID 126605453
9-[3-(tert-butylamino)propyl]-8-[(7-ethenyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]purin-6-amine (PubChem CID 126605453) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 9-[3-(tert-butylamino)propyl]-8-[(7-ethenyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-[3-(tert-butylamino)propyl]-8-[(7-ethenyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 126605453 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 9-[3-(tert-butylamino)propyl]-8-[(7-ethenyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]purin-6-amine |
| SMILES | C=Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(C)(C)C)OCCO2 |
| InChI | InChI=1S/C22H28N6O2S/c1-5-14-11-15-16(30-10-9-29-15)12-17(14)31-21-27-18-19(23)24-13-25-20(18)28(21)8-6-7-26-22(2,3)4/h5,11-13,26H,1,6-10H2,2-4H3,(H2,23,24,25) |
| InChIKey | DOYCYQWUCXGFRV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|