C23H29N7OS — CID 122667852
9-[3-(tert-butylamino)propyl]-8-[(6-ethynyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)sulfanyl]purin-6-amine (PubChem CID 122667852) has the molecular formula C23H29N7OS and a molecular weight of 451.60 g/mol. Its IUPAC name is 9-[3-(tert-butylamino)propyl]-8-[(6-ethynyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-[3-(tert-butylamino)propyl]-8-[(6-ethynyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 122667852 |
| Molecular Formula | C23H29N7OS |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 9-[3-(tert-butylamino)propyl]-8-[(6-ethynyl-2-methyl-3,4-dihydro-2H-1,4-benzoxazin-7-yl)sulfanyl]purin-6-amine |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCCNC(C)(C)C)OC(C)CN2 |
| InChI | InChI=1S/C23H29N7OS/c1-6-15-10-16-17(31-14(2)12-25-16)11-18(15)32-22-29-19-20(24)26-13-27-21(19)30(22)9-7-8-28-23(3,4)5/h1,10-11,13-14,25,28H,7-9,12H2,2-5H3,(H2,24,26,27) |
| InChIKey | IBANAQRWSCEMPV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|