C21H25IN6OS — CID 90073502
N-[3-[6-amino-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]-2-methylpropanamide (PubChem CID 90073502) has the molecular formula C21H25IN6OS and a molecular weight of 536.44 g/mol. Its IUPAC name is N-[3-[6-amino-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[6-amino-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 90073502 |
| Molecular Formula | C21H25IN6OS |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | N-[3-[6-amino-8-[(6-iodo-2,3-dihydro-1H-inden-5-yl)sulfanyl]purin-9-yl]propyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCn1c(Sc2cc3c(cc2I)CCC3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C21H25IN6OS/c1-12(2)20(29)24-7-4-8-28-19-17(18(23)25-11-26-19)27-21(28)30-16-10-14-6-3-5-13(14)9-15(16)22/h9-12H,3-8H2,1-2H3,(H,24,29)(H2,23,25,26) |
| InChIKey | OGUSTEAREVWFAS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|