C19H19IN6O2S — CID 90073044
N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]propanamide (PubChem CID 90073044) has the molecular formula C19H19IN6O2S and a molecular weight of 522.37 g/mol. Its IUPAC name is N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]propanamide.
| Compound Name | N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 90073044 |
| Molecular Formula | C19H19IN6O2S |
| Molecular Weight | 522.37 g/mol |
| Exact Mass | 522.03 |
| IUPAC Name | N-[2-[6-amino-8-[(6-iodo-3-oxo-1,2-dihydroinden-5-yl)sulfanyl]purin-9-yl]ethyl]propanamide |
| SMILES | CCC(=O)NCCn1c(Sc2cc3c(cc2I)CCC3=O)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H19IN6O2S/c1-2-15(28)22-5-6-26-18-16(17(21)23-9-24-18)25-19(26)29-14-8-11-10(7-12(14)20)3-4-13(11)27/h7-9H,2-6H2,1H3,(H,22,28)(H2,21,23,24) |
| InChIKey | BRIMPPVETYRCDY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|