C25H35Cl2N7O2S — CID 121459787
tert-butyl N-[6-[3-[6-amino-8-(3,5-dichlorophenyl)sulfanylpurin-9-yl]propylamino]hexyl]carbamate (PubChem CID 121459787) has the molecular formula C25H35Cl2N7O2S and a molecular weight of 568.58 g/mol. Its IUPAC name is tert-butyl N-[6-[3-[6-amino-8-(3,5-dichlorophenyl)sulfanylpurin-9-yl]propylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[3-[6-amino-8-(3,5-dichlorophenyl)sulfanylpurin-9-yl]propylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 121459787 |
| Molecular Formula | C25H35Cl2N7O2S |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | tert-butyl N-[6-[3-[6-amino-8-(3,5-dichlorophenyl)sulfanylpurin-9-yl]propylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNCCCn1c(Sc2cc(Cl)cc(Cl)c2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C25H35Cl2N7O2S/c1-25(2,3)36-24(35)30-11-7-5-4-6-9-29-10-8-12-34-22-20(21(28)31-16-32-22)33-23(34)37-19-14-17(26)13-18(27)15-19/h13-16,29H,4-12H2,1-3H3,(H,30,35)(H2,28,31,32) |
| InChIKey | BIHOQEALDUGPSQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|