C21H23ClN6S — CID 162531596
8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine;ethane (PubChem CID 162531596) has the molecular formula C21H23ClN6S and a molecular weight of 426.98 g/mol. Its IUPAC name is 8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine;ethane.
| Compound Name | 8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine;ethane |
|---|---|
| PubChem CID | 162531596 |
| Molecular Formula | C21H23ClN6S |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 8-(3-chloro-5-methylphenyl)sulfanyl-9-(2-pyridin-3-ylethyl)purin-6-amine;ethane |
| SMILES | CC.Cc1cc(Cl)cc(Sc2nc3c(N)ncnc3n2CCc2cccnc2)c1 |
| InChI | InChI=1S/C19H17ClN6S.C2H6/c1-12-7-14(20)9-15(8-12)27-19-25-16-17(21)23-11-24-18(16)26(19)6-4-13-3-2-5-22-10-13;1-2/h2-3,5,7-11H,4,6H2,1H3,(H2,21,23,24);1-2H3 |
| InChIKey | IQVAQNCJRCMVMA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |