C12H14N6OS — CID 174590375
9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine (PubChem CID 174590375) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine.
| Compound Name | 9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine |
|---|---|
| PubChem CID | 174590375 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine |
| SMILES | CCCCn1c(Sc2ncco2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C12H14N6OS/c1-2-3-5-18-10-8(9(13)15-7-16-10)17-11(18)20-12-14-4-6-19-12/h4,6-7H,2-3,5H2,1H3,(H2,13,15,16) |
| InChIKey | SHGWGILWUHHZAH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |