C13H19N5O2S — CID 97035787
(2R)-2-(6-amino-9-butylpurin-8-yl)sulfanylbutanoic acid (PubChem CID 97035787) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is (2R)-2-(6-amino-9-butylpurin-8-yl)sulfanylbutanoic acid.
| Compound Name | (2R)-2-(6-amino-9-butylpurin-8-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 97035787 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2R)-2-(6-amino-9-butylpurin-8-yl)sulfanylbutanoic acid |
| SMILES | CCCCn1c(S[C@H](CC)C(=O)O)nc2c(N)ncnc21 |
| InChI | InChI=1S/C13H19N5O2S/c1-3-5-6-18-11-9(10(14)15-7-16-11)17-13(18)21-8(4-2)12(19)20/h7-8H,3-6H2,1-2H3,(H,19,20)(H2,14,15,16)/t8-/m1/s1 |
| InChIKey | QUZOVLWZZUNHAN-MRVPVSSYSA-N |
| XLogP | 2.16 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |