C16H17N5O2S — CID 11302324
3-(6-amino-8-phenylsulfanylpurin-9-yl)propyl acetate (PubChem CID 11302324) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 3-(6-amino-8-phenylsulfanylpurin-9-yl)propyl acetate.
| Compound Name | 3-(6-amino-8-phenylsulfanylpurin-9-yl)propyl acetate |
|---|---|
| PubChem CID | 11302324 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 3-(6-amino-8-phenylsulfanylpurin-9-yl)propyl acetate |
| SMILES | CC(=O)OCCCn1c(Sc2ccccc2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H17N5O2S/c1-11(22)23-9-5-8-21-15-13(14(17)18-10-19-15)20-16(21)24-12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3,(H2,17,18,19) |
| InChIKey | XXIDAZFQVKMXLK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|