C23H29N7S — CID 69338547
9-(4-methylpent-3-enyl)-8-(1-pentylbenzimidazol-2-yl)sulfanylpurin-6-amine (PubChem CID 69338547) has the molecular formula C23H29N7S and a molecular weight of 435.60 g/mol. Its IUPAC name is 9-(4-methylpent-3-enyl)-8-(1-pentylbenzimidazol-2-yl)sulfanylpurin-6-amine.
| Compound Name | 9-(4-methylpent-3-enyl)-8-(1-pentylbenzimidazol-2-yl)sulfanylpurin-6-amine |
|---|---|
| PubChem CID | 69338547 |
| Molecular Formula | C23H29N7S |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 9-(4-methylpent-3-enyl)-8-(1-pentylbenzimidazol-2-yl)sulfanylpurin-6-amine |
| SMILES | CCCCCn1c(Sc2nc3c(N)ncnc3n2CCC=C(C)C)nc2ccccc21 |
| InChI | InChI=1S/C23H29N7S/c1-4-5-8-13-29-18-12-7-6-11-17(18)27-22(29)31-23-28-19-20(24)25-15-26-21(19)30(23)14-9-10-16(2)3/h6-7,10-12,15H,4-5,8-9,13-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | CROCAJDXXBCHIU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|