About 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine
8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine (PubChem CID 16735065) has the molecular formula C19H22BrN5O2S
and a molecular weight of 464.39 g/mol. Its IUPAC name is 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine.
Molecular Properties
| Compound Name | 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine |
| PubChem CID | 16735065 |
| Molecular Formula | C19H22BrN5O2S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine |
| SMILES | COc1cc(Br)c(OC)c(Sc2nc3c(N)ncnc3n2CCC=C(C)C)c1 |
| InChI | InChI=1S/C19H22BrN5O2S/c1-11(2)6-5-7-25-18-15(17(21)22-10-23-18)24-19(25)28-14-9-12(26-3)8-13(20)16(14)27-4/h6,8-10H,5,7H2,1-4H3,(H2,21,22,23) |
| InChIKey | WQSHKQBHYJTGII-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine?
The IUPAC name of 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine (CID 16735065) is 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine.
What is the SMILES notation for 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine?
The canonical SMILES for 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine is COc1cc(Br)c(OC)c(Sc2nc3c(N)ncnc3n2CCC=C(C)C)c1.
What is the InChIKey of 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine?
The InChIKey is WQSHKQBHYJTGII-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BrN5O2S/c1-11(2)6-5-7-25-18-15(17(21)22-10-23-18)24-19(25)28-14-9-12(26-3)8-13(20)16(14)27-4/h6,8-10H,5,7H2,1-4H3,(H2,21,22,23).
What are the key properties of 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine?
8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine has a molecular weight of 464.39 g/mol, XLogP of 4.70, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine is sourced from PubChem (CID 16735065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).