C19H22BrN5O2S — CID 16735065
8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine (PubChem CID 16735065) has the molecular formula C19H22BrN5O2S and a molecular weight of 464.39 g/mol. Its IUPAC name is 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine.
| Compound Name | 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine |
|---|---|
| PubChem CID | 16735065 |
| Molecular Formula | C19H22BrN5O2S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 8-(3-bromo-2,5-dimethoxyphenyl)sulfanyl-9-(4-methylpent-3-enyl)purin-6-amine |
| SMILES | COc1cc(Br)c(OC)c(Sc2nc3c(N)ncnc3n2CCC=C(C)C)c1 |
| InChI | InChI=1S/C19H22BrN5O2S/c1-11(2)6-5-7-25-18-15(17(21)22-10-23-18)24-19(25)28-14-9-12(26-3)8-13(20)16(14)27-4/h6,8-10H,5,7H2,1-4H3,(H2,21,22,23) |
| InChIKey | WQSHKQBHYJTGII-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|