C15H17IN6O3S2 — CID 16737712
N-[2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl]methanesulfonamide (PubChem CID 16737712) has the molecular formula C15H17IN6O3S2 and a molecular weight of 520.38 g/mol. Its IUPAC name is N-[2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 16737712 |
| Molecular Formula | C15H17IN6O3S2 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.98 |
| IUPAC Name | N-[2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl]methanesulfonamide |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H17IN6O3S2/c1-25-9-3-4-10(16)11(7-9)26-15-21-12-13(17)18-8-19-14(12)22(15)6-5-20-27(2,23)24/h3-4,7-8,20H,5-6H2,1-2H3,(H2,17,18,19) |
| InChIKey | PISUHYCWUIRWBS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|