C21H20IN5O4S2 — CID 87785193
2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 87785193) has the molecular formula C21H20IN5O4S2 and a molecular weight of 597.46 g/mol. Its IUPAC name is 2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87785193 |
| Molecular Formula | C21H20IN5O4S2 |
| Molecular Weight | 597.46 g/mol |
| Exact Mass | 597.00 |
| IUPAC Name | 2-[6-amino-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-9-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCOS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C21H20IN5O4S2/c1-13-3-6-15(7-4-13)33(28,29)31-10-9-27-20-18(19(23)24-12-25-20)26-21(27)32-17-11-14(30-2)5-8-16(17)22/h3-8,11-12H,9-10H2,1-2H3,(H2,23,24,25) |
| InChIKey | PBIRMMCRAXLVRC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|