C14H15N5O4S — CID 2212444
6-amino-9-[2-(4-methylphenoxy)ethyl]purine-8-sulfonic acid (PubChem CID 2212444) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is 6-amino-9-[2-(4-methylphenoxy)ethyl]purine-8-sulfonic acid.
| Compound Name | 6-amino-9-[2-(4-methylphenoxy)ethyl]purine-8-sulfonic acid |
|---|---|
| PubChem CID | 2212444 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 6-amino-9-[2-(4-methylphenoxy)ethyl]purine-8-sulfonic acid |
| SMILES | Cc1ccc(OCCn2c(S(=O)(=O)O)nc3c(N)ncnc32)cc1 |
| InChI | InChI=1S/C14H15N5O4S/c1-9-2-4-10(5-3-9)23-7-6-19-13-11(12(15)16-8-17-13)18-14(19)24(20,21)22/h2-5,8H,6-7H2,1H3,(H2,15,16,17)(H,20,21,22) |
| InChIKey | AEMXGAMNTPQPMP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|