C12H10N5O3S- — CID 3633533
6-amino-9-benzylpurine-8-sulfonate (PubChem CID 3633533) has the molecular formula C12H10N5O3S- and a molecular weight of 304.31 g/mol. Its IUPAC name is 6-amino-9-benzylpurine-8-sulfonate.
| Compound Name | 6-amino-9-benzylpurine-8-sulfonate |
|---|---|
| PubChem CID | 3633533 |
| Molecular Formula | C12H10N5O3S- |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 6-amino-9-benzylpurine-8-sulfonate |
| SMILES | Nc1ncnc2c1nc(S(=O)(=O)[O-])n2Cc1ccccc1 |
| InChI | InChI=1S/C12H11N5O3S/c13-10-9-11(15-7-14-10)17(12(16-9)21(18,19)20)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,13,14,15)(H,18,19,20)/p-1 |
| InChIKey | YNXVAEIJYKGOBD-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|