C14H15N7O — CID 91927535
N'-(6-amino-9-benzylpurin-8-yl)acetohydrazide (PubChem CID 91927535) has the molecular formula C14H15N7O and a molecular weight of 297.32 g/mol. Its IUPAC name is N'-(6-amino-9-benzylpurin-8-yl)acetohydrazide.
| Compound Name | N'-(6-amino-9-benzylpurin-8-yl)acetohydrazide |
|---|---|
| PubChem CID | 91927535 |
| Molecular Formula | C14H15N7O |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N'-(6-amino-9-benzylpurin-8-yl)acetohydrazide |
| SMILES | CC(=O)NNc1nc2c(N)ncnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C14H15N7O/c1-9(22)19-20-14-18-11-12(15)16-8-17-13(11)21(14)7-10-5-3-2-4-6-10/h2-6,8H,7H2,1H3,(H,18,20)(H,19,22)(H2,15,16,17) |
| InChIKey | YZHVCKFEFSTVFQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|