C14H12N5O2S- — CID 3633535
2-(6-amino-9-benzylpurin-8-yl)sulfanylacetate (PubChem CID 3633535) has the molecular formula C14H12N5O2S- and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-(6-amino-9-benzylpurin-8-yl)sulfanylacetate.
| Compound Name | 2-(6-amino-9-benzylpurin-8-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3633535 |
| Molecular Formula | C14H12N5O2S- |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-(6-amino-9-benzylpurin-8-yl)sulfanylacetate |
| SMILES | Nc1ncnc2c1nc(SCC(=O)[O-])n2Cc1ccccc1 |
| InChI | InChI=1S/C14H13N5O2S/c15-12-11-13(17-8-16-12)19(6-9-4-2-1-3-5-9)14(18-11)22-7-10(20)21/h1-5,8H,6-7H2,(H,20,21)(H2,15,16,17)/p-1 |
| InChIKey | IUOPLVWEXMRRFJ-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |