C16H17N5O2S — CID 97035789
(2R)-2-(6-amino-9-benzylpurin-8-yl)sulfanylbutanoic acid (PubChem CID 97035789) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is (2R)-2-(6-amino-9-benzylpurin-8-yl)sulfanylbutanoic acid.
| Compound Name | (2R)-2-(6-amino-9-benzylpurin-8-yl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 97035789 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2R)-2-(6-amino-9-benzylpurin-8-yl)sulfanylbutanoic acid |
| SMILES | CC[C@@H](Sc1nc2c(N)ncnc2n1Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H17N5O2S/c1-2-11(15(22)23)24-16-20-12-13(17)18-9-19-14(12)21(16)8-10-6-4-3-5-7-10/h3-7,9,11H,2,8H2,1H3,(H,22,23)(H2,17,18,19)/t11-/m1/s1 |
| InChIKey | NLKTXAHAHRJQAN-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |