C20H25N9O3S2 — CID 122667824
6-amino-8-[5-methoxy-2-(1H-pyrrol-3-yl)phenyl]sulfanyl-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine (PubChem CID 122667824) has the molecular formula C20H25N9O3S2 and a molecular weight of 503.61 g/mol. Its IUPAC name is 6-amino-8-[5-methoxy-2-(1H-pyrrol-3-yl)phenyl]sulfanyl-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine.
| Compound Name | 6-amino-8-[5-methoxy-2-(1H-pyrrol-3-yl)phenyl]sulfanyl-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine |
|---|---|
| PubChem CID | 122667824 |
| Molecular Formula | C20H25N9O3S2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 6-amino-8-[5-methoxy-2-(1H-pyrrol-3-yl)phenyl]sulfanyl-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine |
| SMILES | COc1ccc(-c2cc[nH]c2)c(Sc2nc3c(N)ncnc3n2CCNCCNS(N)(=O)=O)c1 |
| InChI | InChI=1S/C20H25N9O3S2/c1-32-14-2-3-15(13-4-5-24-11-13)16(10-14)33-20-28-17-18(21)25-12-26-19(17)29(20)9-8-23-6-7-27-34(22,30)31/h2-5,10-12,23-24,27H,6-9H2,1H3,(H2,21,25,26)(H2,22,30,31) |
| InChIKey | MCIVSILOVVAXIN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 178.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|