C21H25N9O3S2 — CID 122668014
6-amino-8-[[5-(furan-2-yl)-2,3-dihydro-1H-indol-6-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine (PubChem CID 122668014) has the molecular formula C21H25N9O3S2 and a molecular weight of 515.63 g/mol. Its IUPAC name is 6-amino-8-[[5-(furan-2-yl)-2,3-dihydro-1H-indol-6-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine.
| Compound Name | 6-amino-8-[[5-(furan-2-yl)-2,3-dihydro-1H-indol-6-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine |
|---|---|
| PubChem CID | 122668014 |
| Molecular Formula | C21H25N9O3S2 |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 6-amino-8-[[5-(furan-2-yl)-2,3-dihydro-1H-indol-6-yl]sulfanyl]-9-[2-[2-(sulfamoylamino)ethylamino]ethyl]purine |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1-c1ccco1)CCN3)n2CCNCCNS(N)(=O)=O |
| InChI | InChI=1S/C21H25N9O3S2/c22-19-18-20(27-12-26-19)30(8-7-24-5-6-28-35(23,31)32)21(29-18)34-17-11-15-13(3-4-25-15)10-14(17)16-2-1-9-33-16/h1-2,9-12,24-25,28H,3-8H2,(H2,22,26,27)(H2,23,31,32) |
| InChIKey | MPBHAKHMNVGOCO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 179.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|