C18H16N8O3S — CID 90073009
N-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethyl]formamide (PubChem CID 90073009) has the molecular formula C18H16N8O3S and a molecular weight of 424.45 g/mol. Its IUPAC name is N-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethyl]formamide.
| Compound Name | N-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethyl]formamide |
|---|---|
| PubChem CID | 90073009 |
| Molecular Formula | C18H16N8O3S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | N-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethyl]formamide |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1-c1ccn[nH]1)OCO3)n2CCNC=O |
| InChI | InChI=1S/C18H16N8O3S/c19-16-15-17(22-7-21-16)26(4-3-20-8-27)18(24-15)30-14-6-13-12(28-9-29-13)5-10(14)11-1-2-23-25-11/h1-2,5-8H,3-4,9H2,(H,20,27)(H,23,25)(H2,19,21,22) |
| InChIKey | DCWLJRZMXNJEFG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|