C20H23N9O3S — CID 122667921
3-[2-[6-amino-8-[5-methoxy-2-(1H-pyrazol-5-yl)phenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide (PubChem CID 122667921) has the molecular formula C20H23N9O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is 3-[2-[6-amino-8-[5-methoxy-2-(1H-pyrazol-5-yl)phenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide.
| Compound Name | 3-[2-[6-amino-8-[5-methoxy-2-(1H-pyrazol-5-yl)phenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 122667921 |
| Molecular Formula | C20H23N9O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-[2-[6-amino-8-[5-methoxy-2-(1H-pyrazol-5-yl)phenyl]sulfanylpurin-9-yl]ethylamino]-N-hydroxypropanamide |
| SMILES | COc1ccc(-c2ccn[nH]2)c(Sc2nc3c(N)ncnc3n2CCNCCC(=O)NO)c1 |
| InChI | InChI=1S/C20H23N9O3S/c1-32-12-2-3-13(14-4-7-25-27-14)15(10-12)33-20-26-17-18(21)23-11-24-19(17)29(20)9-8-22-6-5-16(30)28-31/h2-4,7,10-11,22,31H,5-6,8-9H2,1H3,(H,25,27)(H,28,30)(H2,21,23,24) |
| InChIKey | JHBSKDZVOKPNNW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 168.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|