C18H21N5OS — CID 166912378
8-(4-methoxyphenyl)sulfanyl-9-(4-methylpent-4-enyl)purin-6-amine (PubChem CID 166912378) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)sulfanyl-9-(4-methylpent-4-enyl)purin-6-amine.
| Compound Name | 8-(4-methoxyphenyl)sulfanyl-9-(4-methylpent-4-enyl)purin-6-amine |
|---|---|
| PubChem CID | 166912378 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 8-(4-methoxyphenyl)sulfanyl-9-(4-methylpent-4-enyl)purin-6-amine |
| SMILES | C=C(C)CCCn1c(Sc2ccc(OC)cc2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21N5OS/c1-12(2)5-4-10-23-17-15(16(19)20-11-21-17)22-18(23)25-14-8-6-13(24-3)7-9-14/h6-9,11H,1,4-5,10H2,2-3H3,(H2,19,20,21) |
| InChIKey | IRACXNNDDLRDDK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|