C20H24FN7S2 — CID 143496291
[6-amino-9-(5-methylhex-5-enyl)purin-8-yl] N-(5-fluorosulfanyl-4-methyl-3-pyridinyl)ethanimidothioate (PubChem CID 143496291) has the molecular formula C20H24FN7S2 and a molecular weight of 445.59 g/mol. Its IUPAC name is [6-amino-9-(5-methylhex-5-enyl)purin-8-yl] N-(5-fluorosulfanyl-4-methyl-3-pyridinyl)ethanimidothioate.
| Compound Name | [6-amino-9-(5-methylhex-5-enyl)purin-8-yl] N-(5-fluorosulfanyl-4-methyl-3-pyridinyl)ethanimidothioate |
|---|---|
| PubChem CID | 143496291 |
| Molecular Formula | C20H24FN7S2 |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [6-amino-9-(5-methylhex-5-enyl)purin-8-yl] N-(5-fluorosulfanyl-4-methyl-3-pyridinyl)ethanimidothioate |
| SMILES | C=C(C)CCCCn1c(S/C(C)=N/c2cncc(SF)c2C)nc2c(N)ncnc21 |
| InChI | InChI=1S/C20H24FN7S2/c1-12(2)7-5-6-8-28-19-17(18(22)24-11-25-19)27-20(28)29-14(4)26-15-9-23-10-16(30-21)13(15)3/h9-11H,1,5-8H2,2-4H3,(H2,22,24,25)/b26-14+ |
| InChIKey | PMHSBKWDBUFJPM-VULFUBBASA-N |
| XLogP | 5.68 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|