C23H25N7O2S — CID 67115801
6-[6-amino-8-[[6-(1,3-oxazol-2-yl)-2,3-dihydro-1H-inden-5-yl]sulfanyl]purin-9-yl]hexanamide (PubChem CID 67115801) has the molecular formula C23H25N7O2S and a molecular weight of 463.57 g/mol. Its IUPAC name is 6-[6-amino-8-[[6-(1,3-oxazol-2-yl)-2,3-dihydro-1H-inden-5-yl]sulfanyl]purin-9-yl]hexanamide.
| Compound Name | 6-[6-amino-8-[[6-(1,3-oxazol-2-yl)-2,3-dihydro-1H-inden-5-yl]sulfanyl]purin-9-yl]hexanamide |
|---|---|
| PubChem CID | 67115801 |
| Molecular Formula | C23H25N7O2S |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 6-[6-amino-8-[[6-(1,3-oxazol-2-yl)-2,3-dihydro-1H-inden-5-yl]sulfanyl]purin-9-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(Sc2cc3c(cc2-c2ncco2)CCC3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C23H25N7O2S/c24-18(31)7-2-1-3-9-30-21-19(20(25)27-13-28-21)29-23(30)33-17-12-15-6-4-5-14(15)11-16(17)22-26-8-10-32-22/h8,10-13H,1-7,9H2,(H2,24,31)(H2,25,27,28) |
| InChIKey | QSDWEUIRSDRGEW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 138.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|