C23H26AsN6OS — CID 87274843
CID 87274843 (PubChem CID 87274843) has the molecular formula C23H26AsN6OS and a molecular weight of 509.49 g/mol.
| Compound Name | CID 87274843 |
|---|---|
| PubChem CID | 87274843 |
| Molecular Formula | C23H26AsN6OS |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | — |
| SMILES | CC(C)[As]CCCn1c(Sc2cc3c(cc2-c2ncco2)CCC3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C23H26AsN6OS/c1-14(2)24-7-4-9-30-21-19(20(25)27-13-28-21)29-23(30)32-18-12-16-6-3-5-15(16)11-17(18)22-26-8-10-31-22/h8,10-14H,3-7,9H2,1-2H3,(H2,25,27,28) |
| InChIKey | LFTKCUXWYWAAGW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|