C19H23IN6OS — CID 118670540
8-[(6-(131I)iodo-2,3-dihydro-1-benzofuran-5-yl)sulfanyl]-9-[3-(propan-2-yl(13N)amino)propyl]purin-6-amine (PubChem CID 118670540) has the molecular formula C19H23IN6OS and a molecular weight of 513.41 g/mol. Its IUPAC name is 8-[(6-(131I)iodo-2,3-dihydro-1-benzofuran-5-yl)sulfanyl]-9-[3-(propan-2-yl(13N)amino)propyl]purin-6-amine.
| Compound Name | 8-[(6-(131I)iodo-2,3-dihydro-1-benzofuran-5-yl)sulfanyl]-9-[3-(propan-2-yl(13N)amino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 118670540 |
| Molecular Formula | C19H23IN6OS |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 513.07 |
| IUPAC Name | 8-[(6-(131I)iodo-2,3-dihydro-1-benzofuran-5-yl)sulfanyl]-9-[3-(propan-2-yl(13N)amino)propyl]purin-6-amine |
| SMILES | CC(C)[13NH]CCCn1c(Sc2cc3c(cc2[131I])OCC3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H23IN6OS/c1-11(2)22-5-3-6-26-18-16(17(21)23-10-24-18)25-19(26)28-15-8-12-4-7-27-14(12)9-13(15)20/h8-11,22H,3-7H2,1-2H3,(H2,21,23,24)/i20+4,22-1 |
| InChIKey | CIIBAZYPJXIWNJ-GRRNECJPSA-N |
| XLogP | 3.49 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|