C22H21ClN4O3S — CID 141194549
9-[2-(4-chlorophenyl)ethyl]-8-(3,4,5-trimethoxyphenyl)sulfanylpurine (PubChem CID 141194549) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is 9-[2-(4-chlorophenyl)ethyl]-8-(3,4,5-trimethoxyphenyl)sulfanylpurine.
| Compound Name | 9-[2-(4-chlorophenyl)ethyl]-8-(3,4,5-trimethoxyphenyl)sulfanylpurine |
|---|---|
| PubChem CID | 141194549 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 9-[2-(4-chlorophenyl)ethyl]-8-(3,4,5-trimethoxyphenyl)sulfanylpurine |
| SMILES | COc1cc(Sc2nc3cncnc3n2CCc2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21ClN4O3S/c1-28-18-10-16(11-19(29-2)20(18)30-3)31-22-26-17-12-24-13-25-21(17)27(22)9-8-14-4-6-15(23)7-5-14/h4-7,10-13H,8-9H2,1-3H3 |
| InChIKey | SSBYIARJORLFPU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |