C23H24N4O3S — CID 141194540
3-(3-phenylpropyl)-8-(3,4,5-trimethoxyphenyl)sulfanylpurine (PubChem CID 141194540) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is 3-(3-phenylpropyl)-8-(3,4,5-trimethoxyphenyl)sulfanylpurine.
| Compound Name | 3-(3-phenylpropyl)-8-(3,4,5-trimethoxyphenyl)sulfanylpurine |
|---|---|
| PubChem CID | 141194540 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-(3-phenylpropyl)-8-(3,4,5-trimethoxyphenyl)sulfanylpurine |
| SMILES | COc1cc(Sc2nc3cncn(CCCc4ccccc4)c-3n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N4O3S/c1-28-19-12-17(13-20(29-2)21(19)30-3)31-23-25-18-14-24-15-27(22(18)26-23)11-7-10-16-8-5-4-6-9-16/h4-6,8-9,12-15H,7,10-11H2,1-3H3 |
| InChIKey | LUFVBULQBAFCAQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |