C15H16BrN5O2S — CID 68521023
9-(1-bromoethyl)-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine (PubChem CID 68521023) has the molecular formula C15H16BrN5O2S and a molecular weight of 410.30 g/mol. Its IUPAC name is 9-(1-bromoethyl)-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine.
| Compound Name | 9-(1-bromoethyl)-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine |
|---|---|
| PubChem CID | 68521023 |
| Molecular Formula | C15H16BrN5O2S |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 9-(1-bromoethyl)-8-(2,5-dimethoxyphenyl)sulfanylpurin-6-amine |
| SMILES | COc1ccc(OC)c(Sc2nc3c(N)ncnc3n2C(C)Br)c1 |
| InChI | InChI=1S/C15H16BrN5O2S/c1-8(16)21-14-12(13(17)18-7-19-14)20-15(21)24-11-6-9(22-2)4-5-10(11)23-3/h4-8H,1-3H3,(H2,17,18,19) |
| InChIKey | VKWXVOXZAGAXEK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|