C19H26BrN6O5PS — CID 157082527
8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine;trihydroxy(methylidene)-λ5-phosphane (PubChem CID 157082527) has the molecular formula C19H26BrN6O5PS and a molecular weight of 561.40 g/mol. Its IUPAC name is 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine;trihydroxy(methylidene)-λ5-phosphane.
| Compound Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine;trihydroxy(methylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 157082527 |
| Molecular Formula | C19H26BrN6O5PS |
| Molecular Weight | 561.40 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine;trihydroxy(methylidene)-λ5-phosphane |
| SMILES | C=P(O)(O)O.CC(C)CNCCn1c(Sc2cc3c(cc2Br)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C18H21BrN6O2S.CH5O3P/c1-10(2)7-21-3-4-25-17-15(16(20)22-8-23-17)24-18(25)28-14-6-13-12(5-11(14)19)26-9-27-13;1-5(2,3)4/h5-6,8,10,21H,3-4,7,9H2,1-2H3,(H2,20,22,23);2-4H,1H2 |
| InChIKey | ADSFYHAHNCHYJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 160.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|