C16H16BrN5O3S — CID 143645886
8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-(2-ethoxyethyl)purin-6-amine (PubChem CID 143645886) has the molecular formula C16H16BrN5O3S and a molecular weight of 438.31 g/mol. Its IUPAC name is 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-(2-ethoxyethyl)purin-6-amine.
| Compound Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-(2-ethoxyethyl)purin-6-amine |
|---|---|
| PubChem CID | 143645886 |
| Molecular Formula | C16H16BrN5O3S |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-(2-ethoxyethyl)purin-6-amine |
| SMILES | CCOCCn1c(Sc2cc3c(cc2Br)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H16BrN5O3S/c1-2-23-4-3-22-15-13(14(18)19-7-20-15)21-16(22)26-12-6-11-10(5-9(12)17)24-8-25-11/h5-7H,2-4,8H2,1H3,(H2,18,19,20) |
| InChIKey | AITIPPOTUZMENL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|